C11H10BrCl2N3 — CID 103481597
4-(2-bromo-3-chlorophenyl)-3-chloro-5-propyl-1,2,4-triazole (PubChem CID 103481597) has the molecular formula C11H10BrCl2N3 and a molecular weight of 335.03 g/mol. Its IUPAC name is 4-(2-bromo-3-chlorophenyl)-3-chloro-5-propyl-1,2,4-triazole.
| Compound Name | 4-(2-bromo-3-chlorophenyl)-3-chloro-5-propyl-1,2,4-triazole |
|---|---|
| PubChem CID | 103481597 |
| Molecular Formula | C11H10BrCl2N3 |
| Molecular Weight | 335.03 g/mol |
| Exact Mass | 332.94 |
| IUPAC Name | 4-(2-bromo-3-chlorophenyl)-3-chloro-5-propyl-1,2,4-triazole |
| SMILES | CCCc1nnc(Cl)n1-c1cccc(Cl)c1Br |
| InChI | InChI=1S/C11H10BrCl2N3/c1-2-4-9-15-16-11(14)17(9)8-6-3-5-7(13)10(8)12/h3,5-6H,2,4H2,1H3 |
| InChIKey | FANUZNYBNWJSTI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.03 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |