C11H9Cl3FN3 — CID 107579539
3-chloro-4-(3,5-dichloro-4-fluorophenyl)-5-propyl-1,2,4-triazole (PubChem CID 107579539) has the molecular formula C11H9Cl3FN3 and a molecular weight of 308.57 g/mol. Its IUPAC name is 3-chloro-4-(3,5-dichloro-4-fluorophenyl)-5-propyl-1,2,4-triazole.
| Compound Name | 3-chloro-4-(3,5-dichloro-4-fluorophenyl)-5-propyl-1,2,4-triazole |
|---|---|
| PubChem CID | 107579539 |
| Molecular Formula | C11H9Cl3FN3 |
| Molecular Weight | 308.57 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | 3-chloro-4-(3,5-dichloro-4-fluorophenyl)-5-propyl-1,2,4-triazole |
| SMILES | CCCc1nnc(Cl)n1-c1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C11H9Cl3FN3/c1-2-3-9-16-17-11(14)18(9)6-4-7(12)10(15)8(13)5-6/h4-5H,2-3H2,1H3 |
| InChIKey | ZPODXPAZFKGDLO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.57 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|