C13H21N3O3 — CID 103483925
3-[3-(2-methoxyethoxy)propyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 103483925) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 3-[3-(2-methoxyethoxy)propyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 3-[3-(2-methoxyethoxy)propyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 103483925 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 3-[3-(2-methoxyethoxy)propyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | COCCOCCCn1cnc2c(c1=O)CCNC2 |
| InChI | InChI=1S/C13H21N3O3/c1-18-7-8-19-6-2-5-16-10-15-12-9-14-4-3-11(12)13(16)17/h10,14H,2-9H2,1H3 |
| InChIKey | BVEGGZGUYNUDKV-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|