C13H21N3O3 — CID 103484374
ethyl 5-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]-4-oxopentanoate (PubChem CID 103484374) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is ethyl 5-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]-4-oxopentanoate.
| Compound Name | ethyl 5-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]-4-oxopentanoate |
|---|---|
| PubChem CID | 103484374 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | ethyl 5-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]-4-oxopentanoate |
| SMILES | CCOC(=O)CCC(=O)CN(C)Cc1cnn(C)c1 |
| InChI | InChI=1S/C13H21N3O3/c1-4-19-13(18)6-5-12(17)10-15(2)8-11-7-14-16(3)9-11/h7,9H,4-6,8,10H2,1-3H3 |
| InChIKey | XMVXZNUGXVGFDQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |