C12H21N3O3 — CID 63073155
2-ethoxy-4-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]butanoic acid (PubChem CID 63073155) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-ethoxy-4-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]butanoic acid.
| Compound Name | 2-ethoxy-4-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]butanoic acid |
|---|---|
| PubChem CID | 63073155 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 2-ethoxy-4-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]butanoic acid |
| SMILES | CCOC(CCN(C)Cc1cnn(C)c1)C(=O)O |
| InChI | InChI=1S/C12H21N3O3/c1-4-18-11(12(16)17)5-6-14(2)8-10-7-13-15(3)9-10/h7,9,11H,4-6,8H2,1-3H3,(H,16,17) |
| InChIKey | IVGBSMYHQOIRLH-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |