C12H24N4O — CID 62557013
N-(2-ethoxyethyl)-N'-methyl-N'-[(1-methylpyrazol-4-yl)methyl]ethane-1,2-diamine (PubChem CID 62557013) has the molecular formula C12H24N4O and a molecular weight of 240.35 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-N'-methyl-N'-[(1-methylpyrazol-4-yl)methyl]ethane-1,2-diamine.
| Compound Name | N-(2-ethoxyethyl)-N'-methyl-N'-[(1-methylpyrazol-4-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 62557013 |
| Molecular Formula | C12H24N4O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | N-(2-ethoxyethyl)-N'-methyl-N'-[(1-methylpyrazol-4-yl)methyl]ethane-1,2-diamine |
| SMILES | CCOCCNCCN(C)Cc1cnn(C)c1 |
| InChI | InChI=1S/C12H24N4O/c1-4-17-8-6-13-5-7-15(2)10-12-9-14-16(3)11-12/h9,11,13H,4-8,10H2,1-3H3 |
| InChIKey | YVJXLJUZMHASNS-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|