1-ethoxypropan-2-yl 2-fluoro-3-(trifluoromethyl)benzoate

C13H14F4O3 — CID 103490942

IUPAC1-ethoxypropan-2-yl 2-fluoro-3-(trifluoromethyl)benzoate
SMILESCCOCC(C)OC(=O)c1cccc(C(F)(F)F)c1F
InChIInChI=1S/C13H14F4O3/c1-3-19-7-8(2)20-12(18)9-5-4-6-10(11(9)14)13(15,16)17/h4-6,8H,3,7H2,1-2H3
InChIKeyMYLQPZWAJQAHCB-UHFFFAOYSA-N
MW294.24 g/mol
LogP3.43
Rot. Bonds5

About 1-ethoxypropan-2-yl 2-fluoro-3-(trifluoromethyl)benzoate

1-ethoxypropan-2-yl 2-fluoro-3-(trifluoromethyl)benzoate (PubChem CID 103490942) has the molecular formula C13H14F4O3 and a molecular weight of 294.24 g/mol. Its IUPAC name is 1-ethoxypropan-2-yl 2-fluoro-3-(trifluoromethyl)benzoate.

Molecular Properties

Compound Name1-ethoxypropan-2-yl 2-fluoro-3-(trifluoromethyl)benzoate
PubChem CID103490942
Molecular FormulaC13H14F4O3
Molecular Weight294.24 g/mol
Exact Mass294.09
IUPAC Name1-ethoxypropan-2-yl 2-fluoro-3-(trifluoromethyl)benzoate
SMILESCCOCC(C)OC(=O)c1cccc(C(F)(F)F)c1F
InChIInChI=1S/C13H14F4O3/c1-3-19-7-8(2)20-12(18)9-5-4-6-10(11(9)14)13(15,16)17/h4-6,8H,3,7H2,1-2H3
InChIKeyMYLQPZWAJQAHCB-UHFFFAOYSA-N
XLogP3.43
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500294.24
LogP ≤ 53.43
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 1-ethoxypropan-2-yl 2-fluoro-3-(trifluoromethyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-ethoxypropan-2-yl 2-fluoro-3-(trifluoromethyl)benzoate?
The IUPAC name of 1-ethoxypropan-2-yl 2-fluoro-3-(trifluoromethyl)benzoate (CID 103490942) is 1-ethoxypropan-2-yl 2-fluoro-3-(trifluoromethyl)benzoate.
What is the SMILES notation for 1-ethoxypropan-2-yl 2-fluoro-3-(trifluoromethyl)benzoate?
The canonical SMILES for 1-ethoxypropan-2-yl 2-fluoro-3-(trifluoromethyl)benzoate is CCOCC(C)OC(=O)c1cccc(C(F)(F)F)c1F.
What is the InChIKey of 1-ethoxypropan-2-yl 2-fluoro-3-(trifluoromethyl)benzoate?
The InChIKey is MYLQPZWAJQAHCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F4O3/c1-3-19-7-8(2)20-12(18)9-5-4-6-10(11(9)14)13(15,16)17/h4-6,8H,3,7H2,1-2H3.
What are the key properties of 1-ethoxypropan-2-yl 2-fluoro-3-(trifluoromethyl)benzoate?
1-ethoxypropan-2-yl 2-fluoro-3-(trifluoromethyl)benzoate has a molecular weight of 294.24 g/mol, XLogP of 3.43, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxypropan-2-yl 2-fluoro-3-(trifluoromethyl)benzoate is sourced from PubChem (CID 103490942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).