C13H14BrNO4 — CID 103492669
methyl 2-bromo-3-(2,3-dihydro-1-benzofuran-3-carbonylamino)propanoate (PubChem CID 103492669) has the molecular formula C13H14BrNO4 and a molecular weight of 328.16 g/mol. Its IUPAC name is methyl 2-bromo-3-(2,3-dihydro-1-benzofuran-3-carbonylamino)propanoate.
| Compound Name | methyl 2-bromo-3-(2,3-dihydro-1-benzofuran-3-carbonylamino)propanoate |
|---|---|
| PubChem CID | 103492669 |
| Molecular Formula | C13H14BrNO4 |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | methyl 2-bromo-3-(2,3-dihydro-1-benzofuran-3-carbonylamino)propanoate |
| SMILES | COC(=O)C(Br)CNC(=O)C1COc2ccccc21 |
| InChI | InChI=1S/C13H14BrNO4/c1-18-13(17)10(14)6-15-12(16)9-7-19-11-5-3-2-4-8(9)11/h2-5,9-10H,6-7H2,1H3,(H,15,16) |
| InChIKey | PNCRJOKIBGHYPW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|