C39H57N5O2 — CID 10349448
(10S,13S,16R,17S)-17-[2-[4-[3,6-bis(diethylamino)-2-pyridinyl]piperazin-1-yl]acetyl]-10,13,16-trimethyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 10349448) has the molecular formula C39H57N5O2 and a molecular weight of 627.92 g/mol. Its IUPAC name is (10S,13S,16R,17S)-17-[2-[4-[3,6-bis(diethylamino)-2-pyridinyl]piperazin-1-yl]acetyl]-10,13,16-trimethyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (10S,13S,16R,17S)-17-[2-[4-[3,6-bis(diethylamino)-2-pyridinyl]piperazin-1-yl]acetyl]-10,13,16-trimethyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 10349448 |
| Molecular Formula | C39H57N5O2 |
| Molecular Weight | 627.92 g/mol |
| Exact Mass | 627.45 |
| IUPAC Name | (10S,13S,16R,17S)-17-[2-[4-[3,6-bis(diethylamino)-2-pyridinyl]piperazin-1-yl]acetyl]-10,13,16-trimethyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CCN(CC)c1ccc(N(CC)CC)c(N2CCN(CC(=O)[C@H]3[C@H](C)CC4C5CCC6=CC(=O)C=C[C@]6(C)C5=CC[C@@]43C)CC2)n1 |
| InChI | InChI=1S/C39H57N5O2/c1-8-42(9-2)33-14-15-35(43(10-3)11-4)40-37(33)44-22-20-41(21-23-44)26-34(46)36-27(5)24-32-30-13-12-28-25-29(45)16-18-38(28,6)31(30)17-19-39(32,36)7/h14-18,25,27,30,32,36H,8-13,19-24,26H2,1-7H3/t27-,30?,32?,36-,38+,39+/m1/s1 |
| InChIKey | AURBBRTXTSQWSZ-UZJNKIHMSA-N |
| XLogP | 6.56 |
| TPSA | 59.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.92 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|