C30H40ClN3O3 — CID 54585599
(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-[2-(4-pyridin-2-ylpiperazin-1-yl)acetyl]-2,6,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,11-dione;hydrochloride (PubChem CID 54585599) has the molecular formula C30H40ClN3O3 and a molecular weight of 526.12 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-[2-(4-pyridin-2-ylpiperazin-1-yl)acetyl]-2,6,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,11-dione;hydrochloride.
| Compound Name | (8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-[2-(4-pyridin-2-ylpiperazin-1-yl)acetyl]-2,6,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,11-dione;hydrochloride |
|---|---|
| PubChem CID | 54585599 |
| Molecular Formula | C30H40ClN3O3 |
| Molecular Weight | 526.12 g/mol |
| Exact Mass | 525.28 |
| IUPAC Name | (8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-[2-(4-pyridin-2-ylpiperazin-1-yl)acetyl]-2,6,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,11-dione;hydrochloride |
| SMILES | C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@@H]2C(=O)CN1CCN(c2ccccn2)CC1.Cl |
| InChI | InChI=1S/C30H39N3O3.ClH/c1-29-11-10-21(34)17-20(29)6-7-22-23-8-9-24(30(23,2)18-25(35)28(22)29)26(36)19-32-13-15-33(16-14-32)27-5-3-4-12-31-27;/h3-5,12,17,22-24,28H,6-11,13-16,18-19H2,1-2H3;1H/t22-,23-,24+,28+,29-,30-;/m0./s1 |
| InChIKey | VOROLMCSLFVXIW-ZDDVWKKJSA-N |
| XLogP | 4.52 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.12 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'steroid_A(2)', 'substructure': 'N/A'} |
|---|