About (6-fluoro-2,3-dihydroindol-1-yl)-(3-methylpiperidin-1-yl)methanone
(6-fluoro-2,3-dihydroindol-1-yl)-(3-methylpiperidin-1-yl)methanone (PubChem CID 103494882) has the molecular formula C15H19FN2O
and a molecular weight of 262.33 g/mol. Its IUPAC name is (6-fluoro-2,3-dihydroindol-1-yl)-(3-methylpiperidin-1-yl)methanone.
Molecular Properties
| Compound Name | (6-fluoro-2,3-dihydroindol-1-yl)-(3-methylpiperidin-1-yl)methanone |
| PubChem CID | 103494882 |
| Molecular Formula | C15H19FN2O |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | (6-fluoro-2,3-dihydroindol-1-yl)-(3-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCCN(C(=O)N2CCc3ccc(F)cc32)C1 |
| InChI | InChI=1S/C15H19FN2O/c1-11-3-2-7-17(10-11)15(19)18-8-6-12-4-5-13(16)9-14(12)18/h4-5,9,11H,2-3,6-8,10H2,1H3 |
| InChIKey | IPZNMKUKKYYZCI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (6-fluoro-2,3-dihydroindol-1-yl)-(3-methylpiperidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-fluoro-2,3-dihydroindol-1-yl)-(3-methylpiperidin-1-yl)methanone?
The IUPAC name of (6-fluoro-2,3-dihydroindol-1-yl)-(3-methylpiperidin-1-yl)methanone (CID 103494882) is (6-fluoro-2,3-dihydroindol-1-yl)-(3-methylpiperidin-1-yl)methanone.
What is the SMILES notation for (6-fluoro-2,3-dihydroindol-1-yl)-(3-methylpiperidin-1-yl)methanone?
The canonical SMILES for (6-fluoro-2,3-dihydroindol-1-yl)-(3-methylpiperidin-1-yl)methanone is CC1CCCN(C(=O)N2CCc3ccc(F)cc32)C1.
What is the InChIKey of (6-fluoro-2,3-dihydroindol-1-yl)-(3-methylpiperidin-1-yl)methanone?
The InChIKey is IPZNMKUKKYYZCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19FN2O/c1-11-3-2-7-17(10-11)15(19)18-8-6-12-4-5-13(16)9-14(12)18/h4-5,9,11H,2-3,6-8,10H2,1H3.
What are the key properties of (6-fluoro-2,3-dihydroindol-1-yl)-(3-methylpiperidin-1-yl)methanone?
(6-fluoro-2,3-dihydroindol-1-yl)-(3-methylpiperidin-1-yl)methanone has a molecular weight of 262.33 g/mol, XLogP of 3.04, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6-fluoro-2,3-dihydroindol-1-yl)-(3-methylpiperidin-1-yl)methanone is sourced from PubChem (CID 103494882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).