C37H48N8O4 — CID 10349503
2-adamantyl N-[(2S)-1-[[(2S)-1-azido-6-[(2-methylphenyl)carbamoylamino]hexan-2-yl]amino]-3-(1H-indol-3-yl)-2-methyl-1-oxopropan-2-yl]carbamate (PubChem CID 10349503) has the molecular formula C37H48N8O4 and a molecular weight of 668.84 g/mol. Its IUPAC name is 2-adamantyl N-[(2S)-1-[[(2S)-1-azido-6-[(2-methylphenyl)carbamoylamino]hexan-2-yl]amino]-3-(1H-indol-3-yl)-2-methyl-1-oxopropan-2-yl]carbamate.
| Compound Name | 2-adamantyl N-[(2S)-1-[[(2S)-1-azido-6-[(2-methylphenyl)carbamoylamino]hexan-2-yl]amino]-3-(1H-indol-3-yl)-2-methyl-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 10349503 |
| Molecular Formula | C37H48N8O4 |
| Molecular Weight | 668.84 g/mol |
| Exact Mass | 668.38 |
| IUPAC Name | 2-adamantyl N-[(2S)-1-[[(2S)-1-azido-6-[(2-methylphenyl)carbamoylamino]hexan-2-yl]amino]-3-(1H-indol-3-yl)-2-methyl-1-oxopropan-2-yl]carbamate |
| SMILES | Cc1ccccc1NC(=O)NCCCC[C@@H](CN=[N+]=[N-])NC(=O)[C@](C)(Cc1c[nH]c2ccccc12)NC(=O)OC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C37H48N8O4/c1-23-9-3-5-12-31(23)43-35(47)39-14-8-7-10-29(22-41-45-38)42-34(46)37(2,20-28-21-40-32-13-6-4-11-30(28)32)44-36(48)49-33-26-16-24-15-25(18-26)19-27(33)17-24/h3-6,9,11-13,21,24-27,29,33,40H,7-8,10,14-20,22H2,1-2H3,(H,42,46)(H,44,48)(H2,39,43,47)/t24?,25?,26?,27?,29-,33?,37-/m0/s1 |
| InChIKey | XCJRCSXXDHEZHU-XFNVTOGNSA-N |
| XLogP | 7.12 |
| TPSA | 173.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.84 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|