C43H61N5O6Si — CID 101056220
2-trimethylsilylethyl (3S)-3-[[(2R)-2-(2-adamantyloxycarbonylamino)-3-(1H-indol-3-yl)-2-methylpropanoyl]amino]-7-[(2-methylphenyl)carbamoylamino]heptanoate (PubChem CID 101056220) has the molecular formula C43H61N5O6Si and a molecular weight of 772.08 g/mol. Its IUPAC name is 2-trimethylsilylethyl (3S)-3-[[(2R)-2-(2-adamantyloxycarbonylamino)-3-(1H-indol-3-yl)-2-methylpropanoyl]amino]-7-[(2-methylphenyl)carbamoylamino]heptanoate.
| Compound Name | 2-trimethylsilylethyl (3S)-3-[[(2R)-2-(2-adamantyloxycarbonylamino)-3-(1H-indol-3-yl)-2-methylpropanoyl]amino]-7-[(2-methylphenyl)carbamoylamino]heptanoate |
|---|---|
| PubChem CID | 101056220 |
| Molecular Formula | C43H61N5O6Si |
| Molecular Weight | 772.08 g/mol |
| Exact Mass | 771.44 |
| IUPAC Name | 2-trimethylsilylethyl (3S)-3-[[(2R)-2-(2-adamantyloxycarbonylamino)-3-(1H-indol-3-yl)-2-methylpropanoyl]amino]-7-[(2-methylphenyl)carbamoylamino]heptanoate |
| SMILES | Cc1ccccc1NC(=O)NCCCC[C@@H](CC(=O)OCC[Si](C)(C)C)NC(=O)[C@@](C)(Cc1c[nH]c2ccccc12)NC(=O)OC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C43H61N5O6Si/c1-28-12-6-8-15-36(28)47-41(51)44-17-11-10-13-34(25-38(49)53-18-19-55(3,4)5)46-40(50)43(2,26-33-27-45-37-16-9-7-14-35(33)37)48-42(52)54-39-31-21-29-20-30(23-31)24-32(39)22-29/h6-9,12,14-16,27,29-32,34,39,45H,10-11,13,17-26H2,1-5H3,(H,46,50)(H,48,52)(H2,44,47,51)/t29?,30?,31?,32?,34-,39?,43+/m0/s1 |
| InChIKey | DYSKPXMXNDFVEO-ISWPBEOZSA-N |
| XLogP | 8.08 |
| TPSA | 150.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.08 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|