C14H18N2O4 — CID 103497085
4-(3-carbamoyl-2-methylanilino)-2,3-dimethyl-4-oxobutanoic acid (PubChem CID 103497085) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 4-(3-carbamoyl-2-methylanilino)-2,3-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-(3-carbamoyl-2-methylanilino)-2,3-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 103497085 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 4-(3-carbamoyl-2-methylanilino)-2,3-dimethyl-4-oxobutanoic acid |
| SMILES | Cc1c(NC(=O)C(C)C(C)C(=O)O)cccc1C(N)=O |
| InChI | InChI=1S/C14H18N2O4/c1-7(8(2)14(19)20)13(18)16-11-6-4-5-10(9(11)3)12(15)17/h4-8H,1-3H3,(H2,15,17)(H,16,18)(H,19,20) |
| InChIKey | NBBWJFFKVVAUIC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |