C13H22F3NO4 — CID 103497752
4-[3-ethoxypropyl(2,2,2-trifluoroethyl)amino]-2,3-dimethyl-4-oxobutanoic acid (PubChem CID 103497752) has the molecular formula C13H22F3NO4 and a molecular weight of 313.32 g/mol. Its IUPAC name is 4-[3-ethoxypropyl(2,2,2-trifluoroethyl)amino]-2,3-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-[3-ethoxypropyl(2,2,2-trifluoroethyl)amino]-2,3-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 103497752 |
| Molecular Formula | C13H22F3NO4 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 4-[3-ethoxypropyl(2,2,2-trifluoroethyl)amino]-2,3-dimethyl-4-oxobutanoic acid |
| SMILES | CCOCCCN(CC(F)(F)F)C(=O)C(C)C(C)C(=O)O |
| InChI | InChI=1S/C13H22F3NO4/c1-4-21-7-5-6-17(8-13(14,15)16)11(18)9(2)10(3)12(19)20/h9-10H,4-8H2,1-3H3,(H,19,20) |
| InChIKey | SZDZZAVQPFXXMU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|