4-(N-ethyl-3-methylanilino)-2,3-dimethyl-4-oxobutanoic acid

C15H21NO3 — CID 103497969

IUPAC4-(N-ethyl-3-methylanilino)-2,3-dimethyl-4-oxobutanoic acid
SMILESCCN(C(=O)C(C)C(C)C(=O)O)c1cccc(C)c1
InChIInChI=1S/C15H21NO3/c1-5-16(13-8-6-7-10(2)9-13)14(17)11(3)12(4)15(18)19/h6-9,11-12H,5H2,1-4H3,(H,18,19)
InChIKeyGHQPXSXZICWXNR-UHFFFAOYSA-N
MW263.34 g/mol
LogP2.70
Rot. Bonds5

About 4-(N-ethyl-3-methylanilino)-2,3-dimethyl-4-oxobutanoic acid

4-(N-ethyl-3-methylanilino)-2,3-dimethyl-4-oxobutanoic acid (PubChem CID 103497969) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 4-(N-ethyl-3-methylanilino)-2,3-dimethyl-4-oxobutanoic acid.

Molecular Properties

Compound Name4-(N-ethyl-3-methylanilino)-2,3-dimethyl-4-oxobutanoic acid
PubChem CID103497969
Molecular FormulaC15H21NO3
Molecular Weight263.34 g/mol
Exact Mass263.15
IUPAC Name4-(N-ethyl-3-methylanilino)-2,3-dimethyl-4-oxobutanoic acid
SMILESCCN(C(=O)C(C)C(C)C(=O)O)c1cccc(C)c1
InChIInChI=1S/C15H21NO3/c1-5-16(13-8-6-7-10(2)9-13)14(17)11(3)12(4)15(18)19/h6-9,11-12H,5H2,1-4H3,(H,18,19)
InChIKeyGHQPXSXZICWXNR-UHFFFAOYSA-N
XLogP2.70
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.34
LogP ≤ 52.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-(N-ethyl-3-methylanilino)-2,3-dimethyl-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(N-ethyl-3-methylanilino)-2,3-dimethyl-4-oxobutanoic acid?
The IUPAC name of 4-(N-ethyl-3-methylanilino)-2,3-dimethyl-4-oxobutanoic acid (CID 103497969) is 4-(N-ethyl-3-methylanilino)-2,3-dimethyl-4-oxobutanoic acid.
What is the SMILES notation for 4-(N-ethyl-3-methylanilino)-2,3-dimethyl-4-oxobutanoic acid?
The canonical SMILES for 4-(N-ethyl-3-methylanilino)-2,3-dimethyl-4-oxobutanoic acid is CCN(C(=O)C(C)C(C)C(=O)O)c1cccc(C)c1.
What is the InChIKey of 4-(N-ethyl-3-methylanilino)-2,3-dimethyl-4-oxobutanoic acid?
The InChIKey is GHQPXSXZICWXNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO3/c1-5-16(13-8-6-7-10(2)9-13)14(17)11(3)12(4)15(18)19/h6-9,11-12H,5H2,1-4H3,(H,18,19).
What are the key properties of 4-(N-ethyl-3-methylanilino)-2,3-dimethyl-4-oxobutanoic acid?
4-(N-ethyl-3-methylanilino)-2,3-dimethyl-4-oxobutanoic acid has a molecular weight of 263.34 g/mol, XLogP of 2.70, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(N-ethyl-3-methylanilino)-2,3-dimethyl-4-oxobutanoic acid is sourced from PubChem (CID 103497969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).