C18H21NO — CID 113099036
N-ethyl-N,2-bis(3-methylphenyl)acetamide (PubChem CID 113099036) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is N-ethyl-N,2-bis(3-methylphenyl)acetamide.
| Compound Name | N-ethyl-N,2-bis(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 113099036 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | N-ethyl-N,2-bis(3-methylphenyl)acetamide |
| SMILES | CCN(C(=O)Cc1cccc(C)c1)c1cccc(C)c1 |
| InChI | InChI=1S/C18H21NO/c1-4-19(17-10-6-8-15(3)12-17)18(20)13-16-9-5-7-14(2)11-16/h5-12H,4,13H2,1-3H3 |
| InChIKey | XAYHHMHCGDFJGJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |