C16H17NO3 — CID 107735678
N-ethyl-N,2-bis(3-hydroxyphenyl)acetamide (PubChem CID 107735678) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is N-ethyl-N,2-bis(3-hydroxyphenyl)acetamide.
| Compound Name | N-ethyl-N,2-bis(3-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 107735678 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | N-ethyl-N,2-bis(3-hydroxyphenyl)acetamide |
| SMILES | CCN(C(=O)Cc1cccc(O)c1)c1cccc(O)c1 |
| InChI | InChI=1S/C16H17NO3/c1-2-17(13-6-4-8-15(19)11-13)16(20)10-12-5-3-7-14(18)9-12/h3-9,11,18-19H,2,10H2,1H3 |
| InChIKey | OABRZIKDPKPXTO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |