C10H16N2O3 — CID 103498239
4-(1-cyanopropan-2-ylamino)-2,3-dimethyl-4-oxobutanoic acid (PubChem CID 103498239) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 4-(1-cyanopropan-2-ylamino)-2,3-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-(1-cyanopropan-2-ylamino)-2,3-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 103498239 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 4-(1-cyanopropan-2-ylamino)-2,3-dimethyl-4-oxobutanoic acid |
| SMILES | CC(CC#N)NC(=O)C(C)C(C)C(=O)O |
| InChI | InChI=1S/C10H16N2O3/c1-6(4-5-11)12-9(13)7(2)8(3)10(14)15/h6-8H,4H2,1-3H3,(H,12,13)(H,14,15) |
| InChIKey | SJBBFRZQMOECIM-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |