4-(3-bromo-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid

C13H16BrNO4 — CID 103499054

IUPAC4-(3-bromo-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid
SMILESCOc1cc(Br)cc(NC(=O)C(C)C(C)C(=O)O)c1
InChIInChI=1S/C13H16BrNO4/c1-7(8(2)13(17)18)12(16)15-10-4-9(14)5-11(6-10)19-3/h4-8H,1-3H3,(H,15,16)(H,17,18)
InChIKeyMFWHUKWDOZMCLL-UHFFFAOYSA-N
MW330.18 g/mol
LogP2.75
Rot. Bonds5

About 4-(3-bromo-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid

4-(3-bromo-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid (PubChem CID 103499054) has the molecular formula C13H16BrNO4 and a molecular weight of 330.18 g/mol. Its IUPAC name is 4-(3-bromo-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid.

Molecular Properties

Compound Name4-(3-bromo-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid
PubChem CID103499054
Molecular FormulaC13H16BrNO4
Molecular Weight330.18 g/mol
Exact Mass329.03
IUPAC Name4-(3-bromo-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid
SMILESCOc1cc(Br)cc(NC(=O)C(C)C(C)C(=O)O)c1
InChIInChI=1S/C13H16BrNO4/c1-7(8(2)13(17)18)12(16)15-10-4-9(14)5-11(6-10)19-3/h4-8H,1-3H3,(H,15,16)(H,17,18)
InChIKeyMFWHUKWDOZMCLL-UHFFFAOYSA-N
XLogP2.75
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500330.18
LogP ≤ 52.75
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-(3-bromo-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3-bromo-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid?
The IUPAC name of 4-(3-bromo-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid (CID 103499054) is 4-(3-bromo-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid.
What is the SMILES notation for 4-(3-bromo-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid?
The canonical SMILES for 4-(3-bromo-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid is COc1cc(Br)cc(NC(=O)C(C)C(C)C(=O)O)c1.
What is the InChIKey of 4-(3-bromo-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid?
The InChIKey is MFWHUKWDOZMCLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrNO4/c1-7(8(2)13(17)18)12(16)15-10-4-9(14)5-11(6-10)19-3/h4-8H,1-3H3,(H,15,16)(H,17,18).
What are the key properties of 4-(3-bromo-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid?
4-(3-bromo-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid has a molecular weight of 330.18 g/mol, XLogP of 2.75, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-bromo-5-methoxyanilino)-2,3-dimethyl-4-oxobutanoic acid is sourced from PubChem (CID 103499054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).