C13H11F2NO4 — CID 103499598
5-(3,4-dimethyl-2,5-dioxopyrrolidin-1-yl)-2,4-difluorobenzoic acid (PubChem CID 103499598) has the molecular formula C13H11F2NO4 and a molecular weight of 283.23 g/mol. Its IUPAC name is 5-(3,4-dimethyl-2,5-dioxopyrrolidin-1-yl)-2,4-difluorobenzoic acid.
| Compound Name | 5-(3,4-dimethyl-2,5-dioxopyrrolidin-1-yl)-2,4-difluorobenzoic acid |
|---|---|
| PubChem CID | 103499598 |
| Molecular Formula | C13H11F2NO4 |
| Molecular Weight | 283.23 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 5-(3,4-dimethyl-2,5-dioxopyrrolidin-1-yl)-2,4-difluorobenzoic acid |
| SMILES | CC1C(=O)N(c2cc(C(=O)O)c(F)cc2F)C(=O)C1C |
| InChI | InChI=1S/C13H11F2NO4/c1-5-6(2)12(18)16(11(5)17)10-3-7(13(19)20)8(14)4-9(10)15/h3-6H,1-2H3,(H,19,20) |
| InChIKey | GXRGHIMCSKMVDE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.23 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|