C24H27Br4N3O7 — CID 10350332
(2R)-3-[3,5-dibromo-4-[3-[[(5R,6S)-7,9-dibromo-6-hydroxy-8-methoxy-1-oxa-2-azaspiro[4.5]deca-2,7,9-triene-3-carbonyl]amino]propoxy]phenyl]-2-(dimethylamino)propanoic acid (PubChem CID 10350332) has the molecular formula C24H27Br4N3O7 and a molecular weight of 789.11 g/mol. Its IUPAC name is (2R)-3-[3,5-dibromo-4-[3-[[(5R,6S)-7,9-dibromo-6-hydroxy-8-methoxy-1-oxa-2-azaspiro[4.5]deca-2,7,9-triene-3-carbonyl]amino]propoxy]phenyl]-2-(dimethylamino)propanoic acid.
| Compound Name | (2R)-3-[3,5-dibromo-4-[3-[[(5R,6S)-7,9-dibromo-6-hydroxy-8-methoxy-1-oxa-2-azaspiro[4.5]deca-2,7,9-triene-3-carbonyl]amino]propoxy]phenyl]-2-(dimethylamino)propanoic acid |
|---|---|
| PubChem CID | 10350332 |
| Molecular Formula | C24H27Br4N3O7 |
| Molecular Weight | 789.11 g/mol |
| Exact Mass | 784.86 |
| IUPAC Name | (2R)-3-[3,5-dibromo-4-[3-[[(5R,6S)-7,9-dibromo-6-hydroxy-8-methoxy-1-oxa-2-azaspiro[4.5]deca-2,7,9-triene-3-carbonyl]amino]propoxy]phenyl]-2-(dimethylamino)propanoic acid |
| SMILES | COC1=C(Br)[C@@H](O)[C@]2(C=C1Br)CC(C(=O)NCCCOc1c(Br)cc(C[C@H](C(=O)O)N(C)C)cc1Br)=NO2 |
| InChI | InChI=1S/C24H27Br4N3O7/c1-31(2)17(23(34)35)9-12-7-13(25)19(14(26)8-12)37-6-4-5-29-22(33)16-11-24(38-30-16)10-15(27)20(36-3)18(28)21(24)32/h7-8,10,17,21,32H,4-6,9,11H2,1-3H3,(H,29,33)(H,34,35)/t17-,21-,24+/m1/s1 |
| InChIKey | XACCHHISKWLNHN-JKHABCDFSA-N |
| XLogP | 4.08 |
| TPSA | 129.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.11 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|