C15H21Br2N5O4 — CID 162800801
7,9-dibromo-N-[4-(hydrazinylmethylideneamino)butyl]-6-hydroxy-8-methoxy-1-oxa-2-azaspiro[4.5]deca-2,7,9-triene-3-carboxamide (PubChem CID 162800801) has the molecular formula C15H21Br2N5O4 and a molecular weight of 495.17 g/mol. Its IUPAC name is 7,9-dibromo-N-[4-(hydrazinylmethylideneamino)butyl]-6-hydroxy-8-methoxy-1-oxa-2-azaspiro[4.5]deca-2,7,9-triene-3-carboxamide.
| Compound Name | 7,9-dibromo-N-[4-(hydrazinylmethylideneamino)butyl]-6-hydroxy-8-methoxy-1-oxa-2-azaspiro[4.5]deca-2,7,9-triene-3-carboxamide |
|---|---|
| PubChem CID | 162800801 |
| Molecular Formula | C15H21Br2N5O4 |
| Molecular Weight | 495.17 g/mol |
| Exact Mass | 493.00 |
| IUPAC Name | 7,9-dibromo-N-[4-(hydrazinylmethylideneamino)butyl]-6-hydroxy-8-methoxy-1-oxa-2-azaspiro[4.5]deca-2,7,9-triene-3-carboxamide |
| SMILES | COC1=C(Br)C(O)C2(C=C1Br)CC(C(=O)NCCCC/N=C/NN)=NO2 |
| InChI | InChI=1S/C15H21Br2N5O4/c1-25-12-9(16)6-15(13(23)11(12)17)7-10(22-26-15)14(24)20-5-3-2-4-19-8-21-18/h6,8,13,23H,2-5,7,18H2,1H3,(H,19,21)(H,20,24) |
| InChIKey | RWVBJTJJAGSBJA-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 130.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.17 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|