C11H18N4O3S — CID 103506465
3-amino-5-(2-propan-2-yloxyethylamino)thiophene-2,4-dicarboxamide (PubChem CID 103506465) has the molecular formula C11H18N4O3S and a molecular weight of 286.36 g/mol. Its IUPAC name is 3-amino-5-(2-propan-2-yloxyethylamino)thiophene-2,4-dicarboxamide.
| Compound Name | 3-amino-5-(2-propan-2-yloxyethylamino)thiophene-2,4-dicarboxamide |
|---|---|
| PubChem CID | 103506465 |
| Molecular Formula | C11H18N4O3S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 3-amino-5-(2-propan-2-yloxyethylamino)thiophene-2,4-dicarboxamide |
| SMILES | CC(C)OCCNc1sc(C(N)=O)c(N)c1C(N)=O |
| InChI | InChI=1S/C11H18N4O3S/c1-5(2)18-4-3-15-11-6(9(13)16)7(12)8(19-11)10(14)17/h5,15H,3-4,12H2,1-2H3,(H2,13,16)(H2,14,17) |
| InChIKey | GGGKSBRSORTXKD-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 133.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|