C15H22N2OS2 — CID 103506478
1-[3-amino-4-cyclopropyl-5-(2-ethylthiomorpholin-4-yl)thiophen-2-yl]ethanone (PubChem CID 103506478) has the molecular formula C15H22N2OS2 and a molecular weight of 310.49 g/mol. Its IUPAC name is 1-[3-amino-4-cyclopropyl-5-(2-ethylthiomorpholin-4-yl)thiophen-2-yl]ethanone.
| Compound Name | 1-[3-amino-4-cyclopropyl-5-(2-ethylthiomorpholin-4-yl)thiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 103506478 |
| Molecular Formula | C15H22N2OS2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 1-[3-amino-4-cyclopropyl-5-(2-ethylthiomorpholin-4-yl)thiophen-2-yl]ethanone |
| SMILES | CCC1CN(c2sc(C(C)=O)c(N)c2C2CC2)CCS1 |
| InChI | InChI=1S/C15H22N2OS2/c1-3-11-8-17(6-7-19-11)15-12(10-4-5-10)13(16)14(20-15)9(2)18/h10-11H,3-8,16H2,1-2H3 |
| InChIKey | AVRDLNQMGJOLKZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |