C10H14N6O — CID 103510244
N-[4-(aminomethyl)-1-methylpyrazol-3-yl]-3-methylimidazole-4-carboxamide (PubChem CID 103510244) has the molecular formula C10H14N6O and a molecular weight of 234.26 g/mol. Its IUPAC name is N-[4-(aminomethyl)-1-methylpyrazol-3-yl]-3-methylimidazole-4-carboxamide.
| Compound Name | N-[4-(aminomethyl)-1-methylpyrazol-3-yl]-3-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 103510244 |
| Molecular Formula | C10H14N6O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | N-[4-(aminomethyl)-1-methylpyrazol-3-yl]-3-methylimidazole-4-carboxamide |
| SMILES | Cn1cc(CN)c(NC(=O)c2cncn2C)n1 |
| InChI | InChI=1S/C10H14N6O/c1-15-6-12-4-8(15)10(17)13-9-7(3-11)5-16(2)14-9/h4-6H,3,11H2,1-2H3,(H,13,14,17) |
| InChIKey | FRSBHIPUESEPCC-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 90.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |