C11H13N5O2 — CID 114040762
N-[4-(aminomethyl)-1-methylpyrazol-3-yl]-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 114040762) has the molecular formula C11H13N5O2 and a molecular weight of 247.26 g/mol. Its IUPAC name is N-[4-(aminomethyl)-1-methylpyrazol-3-yl]-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[4-(aminomethyl)-1-methylpyrazol-3-yl]-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 114040762 |
| Molecular Formula | C11H13N5O2 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | N-[4-(aminomethyl)-1-methylpyrazol-3-yl]-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | Cn1cc(CN)c(NC(=O)c2ccc(=O)[nH]c2)n1 |
| InChI | InChI=1S/C11H13N5O2/c1-16-6-8(4-12)10(15-16)14-11(18)7-2-3-9(17)13-5-7/h2-3,5-6H,4,12H2,1H3,(H,13,17)(H,14,15,18) |
| InChIKey | NSBICVSMKLRBDH-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |