C10H15N3O3 — CID 103510498
2-methyl-3-[methyl-(3-methylimidazole-4-carbonyl)amino]propanoic acid (PubChem CID 103510498) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 2-methyl-3-[methyl-(3-methylimidazole-4-carbonyl)amino]propanoic acid.
| Compound Name | 2-methyl-3-[methyl-(3-methylimidazole-4-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 103510498 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 2-methyl-3-[methyl-(3-methylimidazole-4-carbonyl)amino]propanoic acid |
| SMILES | CC(CN(C)C(=O)c1cncn1C)C(=O)O |
| InChI | InChI=1S/C10H15N3O3/c1-7(10(15)16)5-12(2)9(14)8-4-11-6-13(8)3/h4,6-7H,5H2,1-3H3,(H,15,16) |
| InChIKey | KSHLTDZBXKEDSY-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |