C10H20N4 — CID 103510883
N-ethyl-N'-[(3-methylimidazol-4-yl)methyl]propane-1,3-diamine (PubChem CID 103510883) has the molecular formula C10H20N4 and a molecular weight of 196.30 g/mol. Its IUPAC name is N-ethyl-N'-[(3-methylimidazol-4-yl)methyl]propane-1,3-diamine.
| Compound Name | N-ethyl-N'-[(3-methylimidazol-4-yl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 103510883 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | N-ethyl-N'-[(3-methylimidazol-4-yl)methyl]propane-1,3-diamine |
| SMILES | CCNCCCNCc1cncn1C |
| InChI | InChI=1S/C10H20N4/c1-3-11-5-4-6-12-7-10-8-13-9-14(10)2/h8-9,11-12H,3-7H2,1-2H3 |
| InChIKey | RKXURCFMYAYCCD-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|