C14H26N4O — CID 119109875
3-(2,6-dimethylmorpholin-4-yl)-N-[(3-methylimidazol-4-yl)methyl]propan-1-amine (PubChem CID 119109875) has the molecular formula C14H26N4O and a molecular weight of 266.39 g/mol. Its IUPAC name is 3-(2,6-dimethylmorpholin-4-yl)-N-[(3-methylimidazol-4-yl)methyl]propan-1-amine.
| Compound Name | 3-(2,6-dimethylmorpholin-4-yl)-N-[(3-methylimidazol-4-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 119109875 |
| Molecular Formula | C14H26N4O |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | 3-(2,6-dimethylmorpholin-4-yl)-N-[(3-methylimidazol-4-yl)methyl]propan-1-amine |
| SMILES | CC1CN(CCCNCc2cncn2C)CC(C)O1 |
| InChI | InChI=1S/C14H26N4O/c1-12-9-18(10-13(2)19-12)6-4-5-15-7-14-8-16-11-17(14)3/h8,11-13,15H,4-7,9-10H2,1-3H3 |
| InChIKey | MVXXACROOIRUFX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|