C15H28N4O — CID 95579532
3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]propan-1-amine (PubChem CID 95579532) has the molecular formula C15H28N4O and a molecular weight of 280.42 g/mol. Its IUPAC name is 3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]propan-1-amine.
| Compound Name | 3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 95579532 |
| Molecular Formula | C15H28N4O |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | 3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]propan-1-amine |
| SMILES | Cc1n[nH]c(C)c1CNCCCN1C[C@@H](C)O[C@H](C)C1 |
| InChI | InChI=1S/C15H28N4O/c1-11-9-19(10-12(2)20-11)7-5-6-16-8-15-13(3)17-18-14(15)4/h11-12,16H,5-10H2,1-4H3,(H,17,18)/t11-,12-/m1/s1 |
| InChIKey | CMINMLFNKLHBRC-VXGBXAGGSA-N |
| XLogP | 1.62 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|