C21H32N4O — CID 119114881
4-(2,6-dimethylmorpholin-4-yl)-N-[[5-(3-methylphenyl)-1H-pyrazol-4-yl]methyl]butan-1-amine (PubChem CID 119114881) has the molecular formula C21H32N4O and a molecular weight of 356.51 g/mol. Its IUPAC name is 4-(2,6-dimethylmorpholin-4-yl)-N-[[5-(3-methylphenyl)-1H-pyrazol-4-yl]methyl]butan-1-amine.
| Compound Name | 4-(2,6-dimethylmorpholin-4-yl)-N-[[5-(3-methylphenyl)-1H-pyrazol-4-yl]methyl]butan-1-amine |
|---|---|
| PubChem CID | 119114881 |
| Molecular Formula | C21H32N4O |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | 4-(2,6-dimethylmorpholin-4-yl)-N-[[5-(3-methylphenyl)-1H-pyrazol-4-yl]methyl]butan-1-amine |
| SMILES | Cc1cccc(-c2[nH]ncc2CNCCCCN2CC(C)OC(C)C2)c1 |
| InChI | InChI=1S/C21H32N4O/c1-16-7-6-8-19(11-16)21-20(13-23-24-21)12-22-9-4-5-10-25-14-17(2)26-18(3)15-25/h6-8,11,13,17-18,22H,4-5,9-10,12,14-15H2,1-3H3,(H,23,24) |
| InChIKey | MGPVUEFKCXJDHQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|