C16H23N3 — CID 4653228
N-[[5-(3,4-dimethylphenyl)-1H-pyrazol-4-yl]methyl]butan-1-amine (PubChem CID 4653228) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is N-[[5-(3,4-dimethylphenyl)-1H-pyrazol-4-yl]methyl]butan-1-amine.
| Compound Name | N-[[5-(3,4-dimethylphenyl)-1H-pyrazol-4-yl]methyl]butan-1-amine |
|---|---|
| PubChem CID | 4653228 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | N-[[5-(3,4-dimethylphenyl)-1H-pyrazol-4-yl]methyl]butan-1-amine |
| SMILES | CCCCNCc1cn[nH]c1-c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C16H23N3/c1-4-5-8-17-10-15-11-18-19-16(15)14-7-6-12(2)13(3)9-14/h6-7,9,11,17H,4-5,8,10H2,1-3H3,(H,18,19) |
| InChIKey | RKOVUYSTNFOUOE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|