C22H29N3 — CID 4034866
N-[[5-(3,4-dimethylphenyl)-1H-pyrazol-4-yl]methyl]adamantan-1-amine (PubChem CID 4034866) has the molecular formula C22H29N3 and a molecular weight of 335.50 g/mol. Its IUPAC name is N-[[5-(3,4-dimethylphenyl)-1H-pyrazol-4-yl]methyl]adamantan-1-amine.
| Compound Name | N-[[5-(3,4-dimethylphenyl)-1H-pyrazol-4-yl]methyl]adamantan-1-amine |
|---|---|
| PubChem CID | 4034866 |
| Molecular Formula | C22H29N3 |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.24 |
| IUPAC Name | N-[[5-(3,4-dimethylphenyl)-1H-pyrazol-4-yl]methyl]adamantan-1-amine |
| SMILES | Cc1ccc(-c2[nH]ncc2CNC23CC4CC(CC(C4)C2)C3)cc1C |
| InChI | InChI=1S/C22H29N3/c1-14-3-4-19(5-15(14)2)21-20(13-24-25-21)12-23-22-9-16-6-17(10-22)8-18(7-16)11-22/h3-5,13,16-18,23H,6-12H2,1-2H3,(H,24,25) |
| InChIKey | GSQYVCNTKHYFQO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |