C19H29N3 — CID 4213258
2-ethyl-N-[[5-(4-methylphenyl)-1H-pyrazol-4-yl]methyl]hexan-1-amine (PubChem CID 4213258) has the molecular formula C19H29N3 and a molecular weight of 299.46 g/mol. Its IUPAC name is 2-ethyl-N-[[5-(4-methylphenyl)-1H-pyrazol-4-yl]methyl]hexan-1-amine.
| Compound Name | 2-ethyl-N-[[5-(4-methylphenyl)-1H-pyrazol-4-yl]methyl]hexan-1-amine |
|---|---|
| PubChem CID | 4213258 |
| Molecular Formula | C19H29N3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | 2-ethyl-N-[[5-(4-methylphenyl)-1H-pyrazol-4-yl]methyl]hexan-1-amine |
| SMILES | CCCCC(CC)CNCc1cn[nH]c1-c1ccc(C)cc1 |
| InChI | InChI=1S/C19H29N3/c1-4-6-7-16(5-2)12-20-13-18-14-21-22-19(18)17-10-8-15(3)9-11-17/h8-11,14,16,20H,4-7,12-13H2,1-3H3,(H,21,22) |
| InChIKey | RVYMOPMBLSRDJG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |