C19H21N3 — CID 112839432
4-ethyl-N-[[5-(4-methylphenyl)-1H-pyrazol-4-yl]methyl]aniline (PubChem CID 112839432) has the molecular formula C19H21N3 and a molecular weight of 291.40 g/mol. Its IUPAC name is 4-ethyl-N-[[5-(4-methylphenyl)-1H-pyrazol-4-yl]methyl]aniline.
| Compound Name | 4-ethyl-N-[[5-(4-methylphenyl)-1H-pyrazol-4-yl]methyl]aniline |
|---|---|
| PubChem CID | 112839432 |
| Molecular Formula | C19H21N3 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 4-ethyl-N-[[5-(4-methylphenyl)-1H-pyrazol-4-yl]methyl]aniline |
| SMILES | CCc1ccc(NCc2cn[nH]c2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C19H21N3/c1-3-15-6-10-18(11-7-15)20-12-17-13-21-22-19(17)16-8-4-14(2)5-9-16/h4-11,13,20H,3,12H2,1-2H3,(H,21,22) |
| InChIKey | PRPWGVGAWYCDJA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |