C19H18F3N3O2S — CID 68723068
4-ethylsulfonyl-N-[[5-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]methyl]aniline (PubChem CID 68723068) has the molecular formula C19H18F3N3O2S and a molecular weight of 409.43 g/mol. Its IUPAC name is 4-ethylsulfonyl-N-[[5-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]methyl]aniline.
| Compound Name | 4-ethylsulfonyl-N-[[5-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]methyl]aniline |
|---|---|
| PubChem CID | 68723068 |
| Molecular Formula | C19H18F3N3O2S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 4-ethylsulfonyl-N-[[5-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]methyl]aniline |
| SMILES | CCS(=O)(=O)c1ccc(NCc2cn[nH]c2-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H18F3N3O2S/c1-2-28(26,27)17-9-7-16(8-10-17)23-11-14-12-24-25-18(14)13-3-5-15(6-4-13)19(20,21)22/h3-10,12,23H,2,11H2,1H3,(H,24,25) |
| InChIKey | BSMDDLSGCOQURO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |