C20H17F3N4O3 — CID 174592126
2-[3-nitro-4-[[5-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]methylamino]phenyl]propanal (PubChem CID 174592126) has the molecular formula C20H17F3N4O3 and a molecular weight of 418.38 g/mol. Its IUPAC name is 2-[3-nitro-4-[[5-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]methylamino]phenyl]propanal.
| Compound Name | 2-[3-nitro-4-[[5-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]methylamino]phenyl]propanal |
|---|---|
| PubChem CID | 174592126 |
| Molecular Formula | C20H17F3N4O3 |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 2-[3-nitro-4-[[5-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]methylamino]phenyl]propanal |
| SMILES | CC(C=O)c1ccc(NCc2cn[nH]c2-c2ccc(C(F)(F)F)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H17F3N4O3/c1-12(11-28)14-4-7-17(18(8-14)27(29)30)24-9-15-10-25-26-19(15)13-2-5-16(6-3-13)20(21,22)23/h2-8,10-12,24H,9H2,1H3,(H,25,26) |
| InChIKey | TWDMYDZMYJLTEQ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|