C20H25N5 — CID 131926386
N-[[5-(4-methylphenyl)-1H-pyrazol-4-yl]methyl]-N'-(5-methyl-2-pyridinyl)propane-1,3-diamine (PubChem CID 131926386) has the molecular formula C20H25N5 and a molecular weight of 335.46 g/mol. Its IUPAC name is N-[[5-(4-methylphenyl)-1H-pyrazol-4-yl]methyl]-N'-(5-methyl-2-pyridinyl)propane-1,3-diamine.
| Compound Name | N-[[5-(4-methylphenyl)-1H-pyrazol-4-yl]methyl]-N'-(5-methyl-2-pyridinyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 131926386 |
| Molecular Formula | C20H25N5 |
| Molecular Weight | 335.46 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | N-[[5-(4-methylphenyl)-1H-pyrazol-4-yl]methyl]-N'-(5-methyl-2-pyridinyl)propane-1,3-diamine |
| SMILES | Cc1ccc(-c2[nH]ncc2CNCCCNc2ccc(C)cn2)cc1 |
| InChI | InChI=1S/C20H25N5/c1-15-4-7-17(8-5-15)20-18(14-24-25-20)13-21-10-3-11-22-19-9-6-16(2)12-23-19/h4-9,12,14,21H,3,10-11,13H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | FQEYLNNMHWRIDA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|