C21H23N5 — CID 78832057
3-(1H-benzimidazol-2-yl)-N-[[5-(4-methylphenyl)-1H-pyrazol-4-yl]methyl]propan-1-amine (PubChem CID 78832057) has the molecular formula C21H23N5 and a molecular weight of 345.45 g/mol. Its IUPAC name is 3-(1H-benzimidazol-2-yl)-N-[[5-(4-methylphenyl)-1H-pyrazol-4-yl]methyl]propan-1-amine.
| Compound Name | 3-(1H-benzimidazol-2-yl)-N-[[5-(4-methylphenyl)-1H-pyrazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 78832057 |
| Molecular Formula | C21H23N5 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | 3-(1H-benzimidazol-2-yl)-N-[[5-(4-methylphenyl)-1H-pyrazol-4-yl]methyl]propan-1-amine |
| SMILES | Cc1ccc(-c2[nH]ncc2CNCCCc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C21H23N5/c1-15-8-10-16(11-9-15)21-17(14-23-26-21)13-22-12-4-7-20-24-18-5-2-3-6-19(18)25-20/h2-3,5-6,8-11,14,22H,4,7,12-13H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | ZVHGAROVERJSRC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|