C16H24N4O — CID 86913988
N-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 86913988) has the molecular formula C16H24N4O and a molecular weight of 288.40 g/mol. Its IUPAC name is N-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 86913988 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | N-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | COc1ccc(-c2[nH]ncc2CNCCCN(C)C)cc1 |
| InChI | InChI=1S/C16H24N4O/c1-20(2)10-4-9-17-11-14-12-18-19-16(14)13-5-7-15(21-3)8-6-13/h5-8,12,17H,4,9-11H2,1-3H3,(H,18,19) |
| InChIKey | GOJYEGGXFXNOKL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|