C18H26N4O — CID 94514892
1-[(2S)-1-ethylpyrrolidin-2-yl]-N-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methyl]methanamine (PubChem CID 94514892) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is 1-[(2S)-1-ethylpyrrolidin-2-yl]-N-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methyl]methanamine.
| Compound Name | 1-[(2S)-1-ethylpyrrolidin-2-yl]-N-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methyl]methanamine |
|---|---|
| PubChem CID | 94514892 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 1-[(2S)-1-ethylpyrrolidin-2-yl]-N-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methyl]methanamine |
| SMILES | CCN1CCC[C@H]1CNCc1cn[nH]c1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H26N4O/c1-3-22-10-4-5-16(22)13-19-11-15-12-20-21-18(15)14-6-8-17(23-2)9-7-14/h6-9,12,16,19H,3-5,10-11,13H2,1-2H3,(H,20,21)/t16-/m0/s1 |
| InChIKey | CJAWTKPDIRAQEQ-INIZCTEOSA-N |
| XLogP | 2.66 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |