C16H23N5 — CID 43764814
1-(1-ethylpyrrolidin-2-yl)-N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]methanamine (PubChem CID 43764814) has the molecular formula C16H23N5 and a molecular weight of 285.39 g/mol. Its IUPAC name is 1-(1-ethylpyrrolidin-2-yl)-N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]methanamine.
| Compound Name | 1-(1-ethylpyrrolidin-2-yl)-N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]methanamine |
|---|---|
| PubChem CID | 43764814 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 1-(1-ethylpyrrolidin-2-yl)-N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]methanamine |
| SMILES | CCN1CCCC1CNCc1cn[nH]c1-c1cccnc1 |
| InChI | InChI=1S/C16H23N5/c1-2-21-8-4-6-15(21)12-18-10-14-11-19-20-16(14)13-5-3-7-17-9-13/h3,5,7,9,11,15,18H,2,4,6,8,10,12H2,1H3,(H,19,20) |
| InChIKey | XTORVKLSZBXHON-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |