C18H21N3O — CID 126456890
N-[[5-(4-ethylphenyl)-1H-pyrazol-4-yl]methyl]-1-(5-methylfuran-2-yl)methanamine (PubChem CID 126456890) has the molecular formula C18H21N3O and a molecular weight of 295.39 g/mol. Its IUPAC name is N-[[5-(4-ethylphenyl)-1H-pyrazol-4-yl]methyl]-1-(5-methylfuran-2-yl)methanamine.
| Compound Name | N-[[5-(4-ethylphenyl)-1H-pyrazol-4-yl]methyl]-1-(5-methylfuran-2-yl)methanamine |
|---|---|
| PubChem CID | 126456890 |
| Molecular Formula | C18H21N3O |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | N-[[5-(4-ethylphenyl)-1H-pyrazol-4-yl]methyl]-1-(5-methylfuran-2-yl)methanamine |
| SMILES | CCc1ccc(-c2[nH]ncc2CNCc2ccc(C)o2)cc1 |
| InChI | InChI=1S/C18H21N3O/c1-3-14-5-7-15(8-6-14)18-16(11-20-21-18)10-19-12-17-9-4-13(2)22-17/h4-9,11,19H,3,10,12H2,1-2H3,(H,20,21) |
| InChIKey | MMMMKPDQZAWZPQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |