C17H23N3O4 — CID 17461527
2-methyl-N-[[5-(4-methylphenyl)-1H-pyrazol-4-yl]methyl]propan-1-amine;oxalic acid (PubChem CID 17461527) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-methyl-N-[[5-(4-methylphenyl)-1H-pyrazol-4-yl]methyl]propan-1-amine;oxalic acid.
| Compound Name | 2-methyl-N-[[5-(4-methylphenyl)-1H-pyrazol-4-yl]methyl]propan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 17461527 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 2-methyl-N-[[5-(4-methylphenyl)-1H-pyrazol-4-yl]methyl]propan-1-amine;oxalic acid |
| SMILES | Cc1ccc(-c2[nH]ncc2CNCC(C)C)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H21N3.C2H2O4/c1-11(2)8-16-9-14-10-17-18-15(14)13-6-4-12(3)5-7-13;3-1(4)2(5)6/h4-7,10-11,16H,8-9H2,1-3H3,(H,17,18);(H,3,4)(H,5,6) |
| InChIKey | RSMWVNFHVMSNEX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|