C11H15N3O3 — CID 103511730
methyl 1-(3-methylimidazole-4-carbonyl)pyrrolidine-3-carboxylate (PubChem CID 103511730) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is methyl 1-(3-methylimidazole-4-carbonyl)pyrrolidine-3-carboxylate.
| Compound Name | methyl 1-(3-methylimidazole-4-carbonyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 103511730 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | methyl 1-(3-methylimidazole-4-carbonyl)pyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)c2cncn2C)C1 |
| InChI | InChI=1S/C11H15N3O3/c1-13-7-12-5-9(13)10(15)14-4-3-8(6-14)11(16)17-2/h5,7-8H,3-4,6H2,1-2H3 |
| InChIKey | PSVANDJLQOGMQX-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |