C9H13F2NO3 — CID 103513328
2-[1-[(2,2-difluoroacetyl)amino]cyclopentyl]acetic acid (PubChem CID 103513328) has the molecular formula C9H13F2NO3 and a molecular weight of 221.20 g/mol. Its IUPAC name is 2-[1-[(2,2-difluoroacetyl)amino]cyclopentyl]acetic acid.
| Compound Name | 2-[1-[(2,2-difluoroacetyl)amino]cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 103513328 |
| Molecular Formula | C9H13F2NO3 |
| Molecular Weight | 221.20 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 2-[1-[(2,2-difluoroacetyl)amino]cyclopentyl]acetic acid |
| SMILES | O=C(O)CC1(NC(=O)C(F)F)CCCC1 |
| InChI | InChI=1S/C9H13F2NO3/c10-7(11)8(15)12-9(5-6(13)14)3-1-2-4-9/h7H,1-5H2,(H,12,15)(H,13,14) |
| InChIKey | HIVAGSNDRAXENW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.20 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |