C14H26N2O3 — CID 64685103
2-[1-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]cyclohexyl]acetic acid (PubChem CID 64685103) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is 2-[1-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 64685103 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 2-[1-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]cyclohexyl]acetic acid |
| SMILES | CC[C@H](C)[C@H](N)C(=O)NC1(CC(=O)O)CCCCC1 |
| InChI | InChI=1S/C14H26N2O3/c1-3-10(2)12(15)13(19)16-14(9-11(17)18)7-5-4-6-8-14/h10,12H,3-9,15H2,1-2H3,(H,16,19)(H,17,18)/t10-,12-/m0/s1 |
| InChIKey | PRAZBTVLRFWWQJ-JQWIXIFHSA-N |
| XLogP | 1.65 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |