C7H6F2O2S — CID 103513670
2,2-difluoro-1-(3-methoxythiophen-2-yl)ethanone (PubChem CID 103513670) has the molecular formula C7H6F2O2S and a molecular weight of 192.19 g/mol. Its IUPAC name is 2,2-difluoro-1-(3-methoxythiophen-2-yl)ethanone.
| Compound Name | 2,2-difluoro-1-(3-methoxythiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 103513670 |
| Molecular Formula | C7H6F2O2S |
| Molecular Weight | 192.19 g/mol |
| Exact Mass | 192.01 |
| IUPAC Name | 2,2-difluoro-1-(3-methoxythiophen-2-yl)ethanone |
| SMILES | COc1ccsc1C(=O)C(F)F |
| InChI | InChI=1S/C7H6F2O2S/c1-11-4-2-3-12-6(4)5(10)7(8)9/h2-3,7H,1H3 |
| InChIKey | BGULTMYXPWUAPN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.19 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |