C7H6BrF2NOS — CID 103513835
N-[(5-bromothiophen-2-yl)methyl]-2,2-difluoroacetamide (PubChem CID 103513835) has the molecular formula C7H6BrF2NOS and a molecular weight of 270.10 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-2,2-difluoroacetamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 103513835 |
| Molecular Formula | C7H6BrF2NOS |
| Molecular Weight | 270.10 g/mol |
| Exact Mass | 268.93 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-2,2-difluoroacetamide |
| SMILES | O=C(NCc1ccc(Br)s1)C(F)F |
| InChI | InChI=1S/C7H6BrF2NOS/c8-5-2-1-4(13-5)3-11-7(12)6(9)10/h1-2,6H,3H2,(H,11,12) |
| InChIKey | QVKLEAQZDWOGLH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.10 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |